C20H20F2N4O3 — CID 4239322
5-[4-(difluoromethoxy)phenyl]-3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazolidine-2,4-dione (PubChem CID 4239322) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4239322 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-3-[[4-(dimethylamino)phenyl]methylideneamino]-5-methylimidazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(C=NN2C(=O)NC(C)(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H20F2N4O3/c1-20(14-6-10-16(11-7-14)29-18(21)22)17(27)26(19(28)24-20)23-12-13-4-8-15(9-5-13)25(2)3/h4-12,18H,1-3H3,(H,24,28) |
| InChIKey | GQMKWQQCHNTSMW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|