C23H28N4O2 — CID 9260859
(5S)-3-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9260859) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (5S)-3-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9260859 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (5S)-3-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCN(CCC)c1ccc(/C=N\N2C(=O)N[C@@](C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-4-15-26(16-5-2)20-13-11-18(12-14-20)17-24-27-21(28)23(3,25-22(27)29)19-9-7-6-8-10-19/h6-14,17H,4-5,15-16H2,1-3H3,(H,25,29)/b24-17-/t23-/m0/s1 |
| InChIKey | KUGLTKLSIZGFFI-HBVBNRCBSA-N |
| XLogP | 4.11 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|