C21H19N5O3 — CID 8980786
(5R)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 8980786) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is (5R)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8980786 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (5R)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | COc1ccc([C@@]2(C)NC(=O)N(/N=C\c3cnn(-c4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H19N5O3/c1-21(16-8-10-18(29-2)11-9-16)19(27)26(20(28)24-21)23-13-15-12-22-25(14-15)17-6-4-3-5-7-17/h3-14H,1-2H3,(H,24,28)/b23-13-/t21-/m1/s1 |
| InChIKey | HSVVVHCCCZDEFF-SGMQAHBGSA-N |
| XLogP | 2.68 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|