C19H16F3N3O3 — CID 8003972
(5S)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 8003972) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is (5S)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8003972 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (5S)-5-(4-methoxyphenyl)-5-methyl-3-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | COc1ccc([C@]2(C)NC(=O)N(/N=C\c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-18(13-7-9-15(28-2)10-8-13)16(26)25(17(27)24-18)23-11-12-3-5-14(6-4-12)19(20,21)22/h3-11H,1-2H3,(H,24,27)/b23-11-/t18-/m0/s1 |
| InChIKey | BNDCKAYHOGCZMO-JHHOAVTDSA-N |
| XLogP | 3.52 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|