C22H16N2O5 — CID 23327370
2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]benzo[de]isoquinoline-1,3-dione (PubChem CID 23327370) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 23327370 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]benzo[de]isoquinoline-1,3-dione |
| SMILES | COc1cc(C=NN2C(=O)c3cccc4cccc(c34)C2=O)cc2c1OCCO2 |
| InChI | InChI=1S/C22H16N2O5/c1-27-17-10-13(11-18-20(17)29-9-8-28-18)12-23-24-21(25)15-6-2-4-14-5-3-7-16(19(14)15)22(24)26/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | RDISBZBJYIDZLX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|