C19H14ClNO5 — CID 26475473
(4Z)-2-(2-chlorophenyl)-4-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 26475473) has the molecular formula C19H14ClNO5 and a molecular weight of 371.78 g/mol. Its IUPAC name is (4Z)-2-(2-chlorophenyl)-4-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chlorophenyl)-4-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 26475473 |
| Molecular Formula | C19H14ClNO5 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (4Z)-2-(2-chlorophenyl)-4-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3Cl)OC2=O)cc2c1OCCO2 |
| InChI | InChI=1S/C19H14ClNO5/c1-23-15-9-11(10-16-17(15)25-7-6-24-16)8-14-19(22)26-18(21-14)12-4-2-3-5-13(12)20/h2-5,8-10H,6-7H2,1H3/b14-8- |
| InChIKey | BNTCAAHAPPPDKZ-ZSOIEALJSA-N |
| XLogP | 3.46 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|