C19H13ClN2O4 — CID 9312808
2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 9312808) has the molecular formula C19H13ClN2O4 and a molecular weight of 368.78 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 9312808 |
| Molecular Formula | C19H13ClN2O4 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3Cl)OC2=O)ccc1OCC#N |
| InChI | InChI=1S/C19H13ClN2O4/c1-24-17-11-12(6-7-16(17)25-9-8-21)10-15-19(23)26-18(22-15)13-4-2-3-5-14(13)20/h2-7,10-11H,9H2,1H3/b15-10- |
| InChIKey | APPZWPNIPCBHLW-GDNBJRDFSA-N |
| XLogP | 3.60 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|