C21H21NO5 — CID 2865589
4-[(3,4-diethoxyphenyl)methylidene]-2-(2-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 2865589) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 4-[(3,4-diethoxyphenyl)methylidene]-2-(2-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(3,4-diethoxyphenyl)methylidene]-2-(2-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2865589 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[(3,4-diethoxyphenyl)methylidene]-2-(2-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C=C2N=C(c3ccccc3OC)OC2=O)cc1OCC |
| InChI | InChI=1S/C21H21NO5/c1-4-25-18-11-10-14(13-19(18)26-5-2)12-16-21(23)27-20(22-16)15-8-6-7-9-17(15)24-3/h6-13H,4-5H2,1-3H3 |
| InChIKey | PANRPHCPFHOWMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|