C21H19F2NO5 — CID 9312987
(4Z)-4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 9312987) has the molecular formula C21H19F2NO5 and a molecular weight of 403.38 g/mol. Its IUPAC name is (4Z)-4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9312987 |
| Molecular Formula | C21H19F2NO5 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (4Z)-4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccccc3OCC)OC2=O)ccc1OC(F)F |
| InChI | InChI=1S/C21H19F2NO5/c1-3-26-16-8-6-5-7-14(16)19-24-15(20(25)29-19)11-13-9-10-17(28-21(22)23)18(12-13)27-4-2/h5-12,21H,3-4H2,1-2H3/b15-11- |
| InChIKey | RILYVXQGRONMFJ-PTNGSMBKSA-N |
| XLogP | 4.43 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|