C22H21F2NO6 — CID 2491027
(4Z)-2-(3,4-diethoxyphenyl)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2491027) has the molecular formula C22H21F2NO6 and a molecular weight of 433.41 g/mol. Its IUPAC name is (4Z)-2-(3,4-diethoxyphenyl)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-diethoxyphenyl)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2491027 |
| Molecular Formula | C22H21F2NO6 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (4Z)-2-(3,4-diethoxyphenyl)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OC(F)F)c(OC)c3)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C22H21F2NO6/c1-4-28-16-9-7-14(12-19(16)29-5-2)20-25-15(21(26)31-20)10-13-6-8-17(30-22(23)24)18(11-13)27-3/h6-12,22H,4-5H2,1-3H3/b15-10- |
| InChIKey | UWZPRBAAIXYSBL-GDNBJRDFSA-N |
| XLogP | 4.44 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|