C24H17F2NO5 — CID 18268408
(4Z)-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 18268408) has the molecular formula C24H17F2NO5 and a molecular weight of 437.40 g/mol. Its IUPAC name is (4Z)-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18268408 |
| Molecular Formula | C24H17F2NO5 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (4Z)-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(C2=N/C(=C\c3cccc(Oc4ccccc4)c3)C(=O)O2)ccc1OC(F)F |
| InChI | InChI=1S/C24H17F2NO5/c1-29-21-14-16(10-11-20(21)31-24(25)26)22-27-19(23(28)32-22)13-15-6-5-9-18(12-15)30-17-7-3-2-4-8-17/h2-14,24H,1H3/b19-13- |
| InChIKey | SSCXGBJTEDUBET-UYRXBGFRSA-N |
| XLogP | 5.43 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|