C20H19NO5 — CID 47046656
(4Z)-2-(3,4-dimethoxyphenyl)-4-[(3-ethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 47046656) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (4Z)-2-(3,4-dimethoxyphenyl)-4-[(3-ethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dimethoxyphenyl)-4-[(3-ethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 47046656 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (4Z)-2-(3,4-dimethoxyphenyl)-4-[(3-ethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1cccc(/C=C2\N=C(c3ccc(OC)c(OC)c3)OC2=O)c1 |
| InChI | InChI=1S/C20H19NO5/c1-4-25-15-7-5-6-13(10-15)11-16-20(22)26-19(21-16)14-8-9-17(23-2)18(12-14)24-3/h5-12H,4H2,1-3H3/b16-11- |
| InChIKey | COMFDTKVORVEAK-WJDWOHSUSA-N |
| XLogP | 3.45 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|