C21H19NO7 — CID 9052142
2-[4-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 9052142) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 9052142 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[4-[(Z)-[2-(2-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | CCOc1ccccc1C1=N/C(=C\c2ccc(OCC(=O)O)c(OC)c2)C(=O)O1 |
| InChI | InChI=1S/C21H19NO7/c1-3-27-16-7-5-4-6-14(16)20-22-15(21(25)29-20)10-13-8-9-17(18(11-13)26-2)28-12-19(23)24/h4-11H,3,12H2,1-2H3,(H,23,24)/b15-10- |
| InChIKey | FEWRFTVJINLFQU-GDNBJRDFSA-N |
| XLogP | 2.90 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|