C25H18ClNO5 — CID 2179555
[4-[(E)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylbenzoate (PubChem CID 2179555) has the molecular formula C25H18ClNO5 and a molecular weight of 447.87 g/mol. Its IUPAC name is [4-[(E)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylbenzoate.
| Compound Name | [4-[(E)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 2179555 |
| Molecular Formula | C25H18ClNO5 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [4-[(E)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylbenzoate |
| SMILES | COc1cc(/C=C2/N=C(c3ccccc3Cl)OC2=O)ccc1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C25H18ClNO5/c1-15-7-3-4-8-17(15)24(28)31-21-12-11-16(14-22(21)30-2)13-20-25(29)32-23(27-20)18-9-5-6-10-19(18)26/h3-14H,1-2H3/b20-13+ |
| InChIKey | PXBCOQMGTJWZSU-DEDYPNTBSA-N |
| XLogP | 5.22 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|