C25H18ClNO6 — CID 4691737
[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate (PubChem CID 4691737) has the molecular formula C25H18ClNO6 and a molecular weight of 463.87 g/mol. Its IUPAC name is [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate.
| Compound Name | [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 4691737 |
| Molecular Formula | C25H18ClNO6 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methoxybenzoate |
| SMILES | COc1cc(C=C2N=C(c3cccc(Cl)c3)OC2=O)ccc1OC(=O)c1ccccc1OC |
| InChI | InChI=1S/C25H18ClNO6/c1-30-20-9-4-3-8-18(20)24(28)32-21-11-10-15(13-22(21)31-2)12-19-25(29)33-23(27-19)16-6-5-7-17(26)14-16/h3-14H,1-2H3 |
| InChIKey | XUTQGINBERTKBI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|