C25H17Cl2NO6 — CID 126202595
[2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126202595) has the molecular formula C25H17Cl2NO6 and a molecular weight of 498.32 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126202595 |
| Molecular Formula | C25H17Cl2NO6 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccc(Cl)cc4Cl)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H17Cl2NO6/c1-31-17-7-4-15(5-8-17)23-28-20(25(30)34-23)11-14-3-10-21(22(12-14)32-2)33-24(29)18-9-6-16(26)13-19(18)27/h3-13H,1-2H3/b20-11- |
| InChIKey | ZROPLIILYUYCAN-JAIQZWGSSA-N |
| XLogP | 5.57 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|