C19H19N3O4 — CID 4521869
[4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)iminomethyl]-2-methoxyphenyl] acetate (PubChem CID 4521869) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)iminomethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)iminomethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 4521869 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [4-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)iminomethyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N/c2ccc3c(c2)n(C)c(=O)n3C)ccc1OC(C)=O |
| InChI | InChI=1S/C19H19N3O4/c1-12(23)26-17-8-5-13(9-18(17)25-4)11-20-14-6-7-15-16(10-14)22(3)19(24)21(15)2/h5-11H,1-4H3/b20-11+ |
| InChIKey | ZXUCIQYWBHIIME-RGVLZGJSSA-N |
| XLogP | 2.56 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|