C12H13NO4 — CID 14578558
[4-[(E,3E)-3-hydroxyiminoprop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 14578558) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is [4-[(E,3E)-3-hydroxyiminoprop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E,3E)-3-hydroxyiminoprop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 14578558 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [4-[(E,3E)-3-hydroxyiminoprop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C=N/O)ccc1OC(C)=O |
| InChI | InChI=1S/C12H13NO4/c1-9(14)17-11-6-5-10(4-3-7-13-15)8-12(11)16-2/h3-8,15H,1-2H3/b4-3+,13-7+ |
| InChIKey | PITLUFCSOKSGEI-LIDPDAEMSA-N |
| XLogP | 2.09 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|