C15H19NO3 — CID 10106724
(NZ)-N-[(E)-3-(3-cyclopentyloxy-4-methoxyphenyl)prop-2-enylidene]hydroxylamine (PubChem CID 10106724) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (NZ)-N-[(E)-3-(3-cyclopentyloxy-4-methoxyphenyl)prop-2-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(E)-3-(3-cyclopentyloxy-4-methoxyphenyl)prop-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 10106724 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (NZ)-N-[(E)-3-(3-cyclopentyloxy-4-methoxyphenyl)prop-2-enylidene]hydroxylamine |
| SMILES | COc1ccc(/C=C/C=N\O)cc1OC1CCCC1 |
| InChI | InChI=1S/C15H19NO3/c1-18-14-9-8-12(5-4-10-16-17)11-15(14)19-13-6-2-3-7-13/h4-5,8-11,13,17H,2-3,6-7H2,1H3/b5-4+,16-10- |
| InChIKey | ALBFUTJILNBNJB-PUSVMIJTSA-N |
| XLogP | 3.49 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|