C14H17NO3 — CID 89146119
2-cyclopentyloxy-1-methoxy-4-[(E)-2-nitrosoethenyl]benzene (PubChem CID 89146119) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-cyclopentyloxy-1-methoxy-4-[(E)-2-nitrosoethenyl]benzene.
| Compound Name | 2-cyclopentyloxy-1-methoxy-4-[(E)-2-nitrosoethenyl]benzene |
|---|---|
| PubChem CID | 89146119 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-cyclopentyloxy-1-methoxy-4-[(E)-2-nitrosoethenyl]benzene |
| SMILES | COc1ccc(/C=C/N=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C14H17NO3/c1-17-13-7-6-11(8-9-15-16)10-14(13)18-12-4-2-3-5-12/h6-10,12H,2-5H2,1H3/b9-8+ |
| InChIKey | JLWICMZMIBGKAR-CMDGGOBGSA-N |
| XLogP | 3.75 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |