C18H28ClN3O3 — CID 173248162
(3-cyclopentyloxy-4-methoxyphenyl)methylidenehydrazine;trimethyl(2-oxoethenyl)azanium;chloride (PubChem CID 173248162) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is (3-cyclopentyloxy-4-methoxyphenyl)methylidenehydrazine;trimethyl(2-oxoethenyl)azanium;chloride.
| Compound Name | (3-cyclopentyloxy-4-methoxyphenyl)methylidenehydrazine;trimethyl(2-oxoethenyl)azanium;chloride |
|---|---|
| PubChem CID | 173248162 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (3-cyclopentyloxy-4-methoxyphenyl)methylidenehydrazine;trimethyl(2-oxoethenyl)azanium;chloride |
| SMILES | COc1ccc(C=NN)cc1OC1CCCC1.C[N+](C)(C)C=C=O.[Cl-] |
| InChI | InChI=1S/C13H18N2O2.C5H10NO.ClH/c1-16-12-7-6-10(9-15-14)8-13(12)17-11-4-2-3-5-11;1-6(2,3)4-5-7;/h6-9,11H,2-5,14H2,1H3;4H,1-3H3;1H/q;+1;/p-1 |
| InChIKey | ZSGNDJPBLCLBBP-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|