C26H31NO5 — CID 67536516
(3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3,4-dimethoxyphenyl)methylidene]piperidin-2-one (PubChem CID 67536516) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3,4-dimethoxyphenyl)methylidene]piperidin-2-one.
| Compound Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3,4-dimethoxyphenyl)methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 67536516 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3,4-dimethoxyphenyl)methylidene]piperidin-2-one |
| SMILES | COc1ccc(/C=C2\C[C@@H](c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)cc1OC |
| InChI | InChI=1S/C26H31NO5/c1-29-22-10-8-17(13-24(22)31-3)12-19-14-20(16-27-26(19)28)18-9-11-23(30-2)25(15-18)32-21-6-4-5-7-21/h8-13,15,20-21H,4-7,14,16H2,1-3H3,(H,27,28)/b19-12+/t20-/m1/s1 |
| InChIKey | OCNORCZFTGXRTO-QDDTUJKSSA-N |
| XLogP | 4.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|