C25H28FNO4 — CID 67535668
(3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-fluoro-4-methoxyphenyl)methylidene]piperidin-2-one (PubChem CID 67535668) has the molecular formula C25H28FNO4 and a molecular weight of 425.50 g/mol. Its IUPAC name is (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-fluoro-4-methoxyphenyl)methylidene]piperidin-2-one.
| Compound Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-fluoro-4-methoxyphenyl)methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 67535668 |
| Molecular Formula | C25H28FNO4 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-fluoro-4-methoxyphenyl)methylidene]piperidin-2-one |
| SMILES | COc1ccc(/C=C2\C[C@@H](c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)cc1F |
| InChI | InChI=1S/C25H28FNO4/c1-29-22-9-7-16(12-21(22)26)11-18-13-19(15-27-25(18)28)17-8-10-23(30-2)24(14-17)31-20-5-3-4-6-20/h7-12,14,19-20H,3-6,13,15H2,1-2H3,(H,27,28)/b18-11+/t19-/m1/s1 |
| InChIKey | RQCCLHNZQZDQPE-WAGPWIPHSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|