C29H37NO5 — CID 67536991
(5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[4-(diethoxymethyl)phenyl]methylidene]piperidin-2-one (PubChem CID 67536991) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[4-(diethoxymethyl)phenyl]methylidene]piperidin-2-one.
| Compound Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[4-(diethoxymethyl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 67536991 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[4-(diethoxymethyl)phenyl]methylidene]piperidin-2-one |
| SMILES | CCOC(OCC)c1ccc(C=C2C[C@@H](c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)cc1 |
| InChI | InChI=1S/C29H37NO5/c1-4-33-29(34-5-2)21-12-10-20(11-13-21)16-23-17-24(19-30-28(23)31)22-14-15-26(32-3)27(18-22)35-25-8-6-7-9-25/h10-16,18,24-25,29H,4-9,17,19H2,1-3H3,(H,30,31)/t24-/m1/s1 |
| InChIKey | VEXSPVQROLUGPM-XMMPIXPASA-N |
| XLogP | 5.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|