C17H20O5 — CID 71601856
4-(3-cyclopentyloxy-4-methoxyphenyl)oxane-2,6-dione (PubChem CID 71601856) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-(3-cyclopentyloxy-4-methoxyphenyl)oxane-2,6-dione.
| Compound Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)oxane-2,6-dione |
|---|---|
| PubChem CID | 71601856 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)oxane-2,6-dione |
| SMILES | COc1ccc(C2CC(=O)OC(=O)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C17H20O5/c1-20-14-7-6-11(12-9-16(18)22-17(19)10-12)8-15(14)21-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3 |
| InChIKey | HRYVAUWVBZPVCQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|