C22H32N2O4 — CID 54134810
4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidin-2-one (PubChem CID 54134810) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidin-2-one.
| Compound Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 54134810 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidin-2-one |
| SMILES | COc1ccc(C2CC(=O)N(CCN3CCOCC3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C22H32N2O4/c1-26-20-7-6-17(14-21(20)28-19-4-2-3-5-19)18-15-22(25)24(16-18)9-8-23-10-12-27-13-11-23/h6-7,14,18-19H,2-5,8-13,15-16H2,1H3 |
| InChIKey | NWXPKPTXPIFALS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |