C23H26FNO3 — CID 10293339
(4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]pyrrolidin-2-one (PubChem CID 10293339) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10293339 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc([C@H]2CC(=O)N(Cc3cccc(F)c3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H26FNO3/c1-27-21-10-9-17(12-22(21)28-20-7-2-3-8-20)18-13-23(26)25(15-18)14-16-5-4-6-19(24)11-16/h4-6,9-12,18,20H,2-3,7-8,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | XSNZHLZBNOJCAD-SFHVURJKSA-N |
| XLogP | 4.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |