C23H31NO3 — CID 67536120
(5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3,3-bis(prop-2-enyl)piperidin-2-one (PubChem CID 67536120) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3,3-bis(prop-2-enyl)piperidin-2-one.
| Compound Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3,3-bis(prop-2-enyl)piperidin-2-one |
|---|---|
| PubChem CID | 67536120 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3,3-bis(prop-2-enyl)piperidin-2-one |
| SMILES | C=CCC1(CC=C)C[C@@H](c2ccc(OC)c(OC3CCCC3)c2)CNC1=O |
| InChI | InChI=1S/C23H31NO3/c1-4-12-23(13-5-2)15-18(16-24-22(23)25)17-10-11-20(26-3)21(14-17)27-19-8-6-7-9-19/h4-5,10-11,14,18-19H,1-2,6-9,12-13,15-16H2,3H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | YURZPWLYXURAHU-GOSISDBHSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|