C25H31NO3 — CID 67540095
(5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-phenylethyl)piperidin-2-one (PubChem CID 67540095) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-phenylethyl)piperidin-2-one.
| Compound Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-phenylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 67540095 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-phenylethyl)piperidin-2-one |
| SMILES | COc1ccc([C@H]2CNC(=O)C(C(C)c3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H31NO3/c1-17(18-8-4-3-5-9-18)22-14-20(16-26-25(22)27)19-12-13-23(28-2)24(15-19)29-21-10-6-7-11-21/h3-5,8-9,12-13,15,17,20-22H,6-7,10-11,14,16H2,1-2H3,(H,26,27)/t17?,20-,22?/m1/s1 |
| InChIKey | BTESUUNTJKFHCD-LVKMRUPZSA-N |
| XLogP | 5.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |