C31H43NO4 — CID 67538407
(3S,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-heptoxyphenyl)methyl]piperidin-2-one (PubChem CID 67538407) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (3S,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-heptoxyphenyl)methyl]piperidin-2-one.
| Compound Name | (3S,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-heptoxyphenyl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 67538407 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (3S,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-heptoxyphenyl)methyl]piperidin-2-one |
| SMILES | CCCCCCCOc1cccc(C[C@@H]2C[C@@H](c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)c1 |
| InChI | InChI=1S/C31H43NO4/c1-3-4-5-6-9-17-35-28-14-10-11-23(19-28)18-25-20-26(22-32-31(25)33)24-15-16-29(34-2)30(21-24)36-27-12-7-8-13-27/h10-11,14-16,19,21,25-27H,3-9,12-13,17-18,20,22H2,1-2H3,(H,32,33)/t25-,26-/m1/s1 |
| InChIKey | AHEORZCIMGUFPM-CLJLJLNGSA-N |
| XLogP | 6.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|