C30H41NO4 — CID 67540998
(3R,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-hexoxyphenyl)methyl]piperidin-2-one (PubChem CID 67540998) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is (3R,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-hexoxyphenyl)methyl]piperidin-2-one.
| Compound Name | (3R,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-hexoxyphenyl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 67540998 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (3R,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(3-hexoxyphenyl)methyl]piperidin-2-one |
| SMILES | CCCCCCOc1cccc(C[C@H]2C[C@@H](c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)c1 |
| InChI | InChI=1S/C30H41NO4/c1-3-4-5-8-16-34-27-13-9-10-22(18-27)17-24-19-25(21-31-30(24)32)23-14-15-28(33-2)29(20-23)35-26-11-6-7-12-26/h9-10,13-15,18,20,24-26H,3-8,11-12,16-17,19,21H2,1-2H3,(H,31,32)/t24-,25+/m0/s1 |
| InChIKey | JKPXEYLLLHQYAJ-LOSJGSFVSA-N |
| XLogP | 6.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|