C27H36N2O3 — CID 77309850
5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[3-(propylamino)phenyl]methyl]piperidin-2-one (PubChem CID 77309850) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[3-(propylamino)phenyl]methyl]piperidin-2-one.
| Compound Name | 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[3-(propylamino)phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 77309850 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[[3-(propylamino)phenyl]methyl]piperidin-2-one |
| SMILES | CCCNc1cccc(CC2CC(c3ccc(OC)c(OC4CCCC4)c3)CNC2=O)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-3-13-28-23-8-6-7-19(15-23)14-21-16-22(18-29-27(21)30)20-11-12-25(31-2)26(17-20)32-24-9-4-5-10-24/h6-8,11-12,15,17,21-22,24,28H,3-5,9-10,13-14,16,18H2,1-2H3,(H,29,30) |
| InChIKey | TXQNDBLQMOLYBP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |