C27H29N3O3 — CID 67535720
(3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(4-imidazol-1-ylphenyl)methylidene]piperidin-2-one (PubChem CID 67535720) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(4-imidazol-1-ylphenyl)methylidene]piperidin-2-one.
| Compound Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(4-imidazol-1-ylphenyl)methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 67535720 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (3E,5S)-5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(4-imidazol-1-ylphenyl)methylidene]piperidin-2-one |
| SMILES | COc1ccc([C@H]2CNC(=O)/C(=C/c3ccc(-n4ccnc4)cc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H29N3O3/c1-32-25-11-8-20(16-26(25)33-24-4-2-3-5-24)22-15-21(27(31)29-17-22)14-19-6-9-23(10-7-19)30-13-12-28-18-30/h6-14,16,18,22,24H,2-5,15,17H2,1H3,(H,29,31)/b21-14+/t22-/m1/s1 |
| InChIKey | INLADQWTKLXZFI-QJUACMODSA-N |
| XLogP | 4.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|