C24H25F2NO3 — CID 67537340
5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(2,3-difluorophenyl)methylidene]piperidin-2-one (PubChem CID 67537340) has the molecular formula C24H25F2NO3 and a molecular weight of 413.46 g/mol. Its IUPAC name is 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(2,3-difluorophenyl)methylidene]piperidin-2-one.
| Compound Name | 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(2,3-difluorophenyl)methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 67537340 |
| Molecular Formula | C24H25F2NO3 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-(3-cyclopentyloxy-4-methoxyphenyl)-3-[(2,3-difluorophenyl)methylidene]piperidin-2-one |
| SMILES | COc1ccc(C2CNC(=O)C(=Cc3cccc(F)c3F)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H25F2NO3/c1-29-21-10-9-15(13-22(21)30-19-6-2-3-7-19)18-12-17(24(28)27-14-18)11-16-5-4-8-20(25)23(16)26/h4-5,8-11,13,18-19H,2-3,6-7,12,14H2,1H3,(H,27,28) |
| InChIKey | IDCNUQBPYZCTSF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|