C25H27NO5 — CID 67537140
(3E,5S)-3-(1,3-benzodioxol-4-ylmethylidene)-5-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-2-one (PubChem CID 67537140) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (3E,5S)-3-(1,3-benzodioxol-4-ylmethylidene)-5-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-2-one.
| Compound Name | (3E,5S)-3-(1,3-benzodioxol-4-ylmethylidene)-5-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 67537140 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (3E,5S)-3-(1,3-benzodioxol-4-ylmethylidene)-5-(3-cyclopentyloxy-4-methoxyphenyl)piperidin-2-one |
| SMILES | COc1ccc([C@H]2CNC(=O)/C(=C/c3cccc4c3OCO4)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H27NO5/c1-28-21-10-9-16(13-23(21)31-20-6-2-3-7-20)19-12-18(25(27)26-14-19)11-17-5-4-8-22-24(17)30-15-29-22/h4-5,8-11,13,19-20H,2-3,6-7,12,14-15H2,1H3,(H,26,27)/b18-11+/t19-/m1/s1 |
| InChIKey | KJJCSWCQNCLXRL-WAGPWIPHSA-N |
| XLogP | 4.43 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|