C19H26N2O4 — CID 110173499
1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]piperidine-4-carboxylic acid (PubChem CID 110173499) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]piperidine-4-carboxylic acid.
| Compound Name | 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 110173499 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(E)-(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(/C=N/N2CCC(C(=O)O)CC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H26N2O4/c1-24-17-7-6-14(12-18(17)25-16-4-2-3-5-16)13-20-21-10-8-15(9-11-21)19(22)23/h6-7,12-13,15-16H,2-5,8-11H2,1H3,(H,22,23)/b20-13+ |
| InChIKey | OTIYKUFTTYTPRB-DEDYPNTBSA-N |
| XLogP | 3.15 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|