C19H24O6 — CID 85045270
dimethyl 2-[(3-cyclopentyloxy-4-methoxyphenyl)methylidene]butanedioate (PubChem CID 85045270) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is dimethyl 2-[(3-cyclopentyloxy-4-methoxyphenyl)methylidene]butanedioate.
| Compound Name | dimethyl 2-[(3-cyclopentyloxy-4-methoxyphenyl)methylidene]butanedioate |
|---|---|
| PubChem CID | 85045270 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | dimethyl 2-[(3-cyclopentyloxy-4-methoxyphenyl)methylidene]butanedioate |
| SMILES | COC(=O)CC(=Cc1ccc(OC)c(OC2CCCC2)c1)C(=O)OC |
| InChI | InChI=1S/C19H24O6/c1-22-16-9-8-13(11-17(16)25-15-6-4-5-7-15)10-14(19(21)24-3)12-18(20)23-2/h8-11,15H,4-7,12H2,1-3H3 |
| InChIKey | NRNYHSBGWFIHAJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|