C21H21NO2 — CID 67598126
(Z)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylprop-2-enenitrile (PubChem CID 67598126) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (Z)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 67598126 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (Z)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylprop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2ccccc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H21NO2/c1-23-20-12-11-16(14-21(20)24-19-9-5-6-10-19)13-18(15-22)17-7-3-2-4-8-17/h2-4,7-8,11-14,19H,5-6,9-10H2,1H3/b18-13+ |
| InChIKey | RKCTYOVASRHDFB-QGOAFFKASA-N |
| XLogP | 5.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|