C26H25ClO2 — CID 70076005
4-[(E)-2-(4-chlorophenyl)-1-phenylethenyl]-2-cyclopentyloxy-1-methoxybenzene (PubChem CID 70076005) has the molecular formula C26H25ClO2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 4-[(E)-2-(4-chlorophenyl)-1-phenylethenyl]-2-cyclopentyloxy-1-methoxybenzene.
| Compound Name | 4-[(E)-2-(4-chlorophenyl)-1-phenylethenyl]-2-cyclopentyloxy-1-methoxybenzene |
|---|---|
| PubChem CID | 70076005 |
| Molecular Formula | C26H25ClO2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[(E)-2-(4-chlorophenyl)-1-phenylethenyl]-2-cyclopentyloxy-1-methoxybenzene |
| SMILES | COc1ccc(/C(=C/c2ccc(Cl)cc2)c2ccccc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H25ClO2/c1-28-25-16-13-21(18-26(25)29-23-9-5-6-10-23)24(20-7-3-2-4-8-20)17-19-11-14-22(27)15-12-19/h2-4,7-8,11-18,23H,5-6,9-10H2,1H3/b24-17+ |
| InChIKey | YKOCSPBPWHQZOG-JJIBRWJFSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|