C28H29NO4 — CID 139988631
ethyl 4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]benzoate (PubChem CID 139988631) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl 4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]benzoate.
| Compound Name | ethyl 4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]benzoate |
|---|---|
| PubChem CID | 139988631 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl 4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=Cc2ccncc2)c2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-3-32-28(30)22-10-8-21(9-11-22)25(18-20-14-16-29-17-15-20)23-12-13-26(31-2)27(19-23)33-24-6-4-5-7-24/h8-19,24H,3-7H2,1-2H3 |
| InChIKey | PMXSUKXJEKLCPZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |