C27H26O4 — CID 54106348
3-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethenyl]benzoic acid (PubChem CID 54106348) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethenyl]benzoic acid.
| Compound Name | 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethenyl]benzoic acid |
|---|---|
| PubChem CID | 54106348 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethenyl]benzoic acid |
| SMILES | COc1ccc(C(=Cc2cccc(C(=O)O)c2)c2ccccc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H26O4/c1-30-25-15-14-21(18-26(25)31-23-12-5-6-13-23)24(20-9-3-2-4-10-20)17-19-8-7-11-22(16-19)27(28)29/h2-4,7-11,14-18,23H,5-6,12-13H2,1H3,(H,28,29) |
| InChIKey | NEAHRSRQEUGVIS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|