C28H30N2O4 — CID 54207285
ethyl N-[4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]phenyl]carbamate (PubChem CID 54207285) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl N-[4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 54207285 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethyl N-[4-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-pyridin-4-ylethenyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C(=Cc2ccncc2)c2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C28H30N2O4/c1-3-33-28(31)30-23-11-8-21(9-12-23)25(18-20-14-16-29-17-15-20)22-10-13-26(32-2)27(19-22)34-24-6-4-5-7-24/h8-19,24H,3-7H2,1-2H3,(H,30,31) |
| InChIKey | PTJTYBXCAAQCFS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |