C14H19NO3 — CID 117376031
2-amino-1-(3-cyclopentyloxy-4-methoxyphenyl)ethanone (PubChem CID 117376031) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-amino-1-(3-cyclopentyloxy-4-methoxyphenyl)ethanone.
| Compound Name | 2-amino-1-(3-cyclopentyloxy-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 117376031 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-amino-1-(3-cyclopentyloxy-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CN)cc1OC1CCCC1 |
| InChI | InChI=1S/C14H19NO3/c1-17-13-7-6-10(12(16)9-15)8-14(13)18-11-4-2-3-5-11/h6-8,11H,2-5,9,15H2,1H3 |
| InChIKey | JSNCXOGNQWYIRA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |