C18H19NO3 — CID 54358933
(3-cyclopentyloxy-4-methoxyphenyl)-pyridin-2-ylmethanone (PubChem CID 54358933) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3-cyclopentyloxy-4-methoxyphenyl)-pyridin-2-ylmethanone.
| Compound Name | (3-cyclopentyloxy-4-methoxyphenyl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 54358933 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3-cyclopentyloxy-4-methoxyphenyl)-pyridin-2-ylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccn2)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H19NO3/c1-21-16-10-9-13(18(20)15-8-4-5-11-19-15)12-17(16)22-14-6-2-3-7-14/h4-5,8-12,14H,2-3,6-7H2,1H3 |
| InChIKey | ULCFHPUJMXJDCX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |