C24H29N3O4 — CID 55808317
1-(4-cyclopentyloxy-3-methoxybenzoyl)-N-pyridin-2-ylpiperidine-4-carboxamide (PubChem CID 55808317) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-(4-cyclopentyloxy-3-methoxybenzoyl)-N-pyridin-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(4-cyclopentyloxy-3-methoxybenzoyl)-N-pyridin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55808317 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-(4-cyclopentyloxy-3-methoxybenzoyl)-N-pyridin-2-ylpiperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)Nc3ccccn3)CC2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C24H29N3O4/c1-30-21-16-18(9-10-20(21)31-19-6-2-3-7-19)24(29)27-14-11-17(12-15-27)23(28)26-22-8-4-5-13-25-22/h4-5,8-10,13,16-17,19H,2-3,6-7,11-12,14-15H2,1H3,(H,25,26,28) |
| InChIKey | WULKZDASLRFCDU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |