C21H24N4O7 — CID 55808350
N-pyridin-2-yl-1-(3,4,5-trimethoxy-2-nitrobenzoyl)piperidine-4-carboxamide (PubChem CID 55808350) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is N-pyridin-2-yl-1-(3,4,5-trimethoxy-2-nitrobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-pyridin-2-yl-1-(3,4,5-trimethoxy-2-nitrobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55808350 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-pyridin-2-yl-1-(3,4,5-trimethoxy-2-nitrobenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)Nc3ccccn3)CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C21H24N4O7/c1-30-15-12-14(17(25(28)29)19(32-3)18(15)31-2)21(27)24-10-7-13(8-11-24)20(26)23-16-6-4-5-9-22-16/h4-6,9,12-13H,7-8,10-11H2,1-3H3,(H,22,23,26) |
| InChIKey | YVEWTGCTWFHSJZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|