C21H23ClN4O6 — CID 55813064
N-(5-chloro-2-pyridinyl)-1-(4-ethoxy-5-methoxy-2-nitrobenzoyl)piperidine-4-carboxamide (PubChem CID 55813064) has the molecular formula C21H23ClN4O6 and a molecular weight of 462.89 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-(4-ethoxy-5-methoxy-2-nitrobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-(4-ethoxy-5-methoxy-2-nitrobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55813064 |
| Molecular Formula | C21H23ClN4O6 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-(4-ethoxy-5-methoxy-2-nitrobenzoyl)piperidine-4-carboxamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N2CCC(C(=O)Nc3ccc(Cl)cn3)CC2)cc1OC |
| InChI | InChI=1S/C21H23ClN4O6/c1-3-32-18-11-16(26(29)30)15(10-17(18)31-2)21(28)25-8-6-13(7-9-25)20(27)24-19-5-4-14(22)12-23-19/h4-5,10-13H,3,6-9H2,1-2H3,(H,23,24,27) |
| InChIKey | ZPOYYBWRXLJBKV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|