C21H23N3O8 — CID 55546101
3,4,5-trimethoxy-N-[2-(morpholine-4-carbonyl)phenyl]-2-nitrobenzamide (PubChem CID 55546101) has the molecular formula C21H23N3O8 and a molecular weight of 445.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(morpholine-4-carbonyl)phenyl]-2-nitrobenzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-(morpholine-4-carbonyl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 55546101 |
| Molecular Formula | C21H23N3O8 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(morpholine-4-carbonyl)phenyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N2CCOCC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C21H23N3O8/c1-29-16-12-14(17(24(27)28)19(31-3)18(16)30-2)20(25)22-15-7-5-4-6-13(15)21(26)23-8-10-32-11-9-23/h4-7,12H,8-11H2,1-3H3,(H,22,25) |
| InChIKey | WXRIERQULLLLNW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|