C20H19N3O7 — CID 3938037
methyl 3-[[2-(morpholine-4-carbonyl)phenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 3938037) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is methyl 3-[[2-(morpholine-4-carbonyl)phenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[2-(morpholine-4-carbonyl)phenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 3938037 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 3-[[2-(morpholine-4-carbonyl)phenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2ccccc2C(=O)N2CCOCC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N3O7/c1-29-20(26)14-10-13(11-15(12-14)23(27)28)18(24)21-17-5-3-2-4-16(17)19(25)22-6-8-30-9-7-22/h2-5,10-12H,6-9H2,1H3,(H,21,24) |
| InChIKey | AQAYODBVTHMTQZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|