C19H21N3O8 — CID 34470441
furan-2-yl-[4-(3,4,5-trimethoxy-2-nitrobenzoyl)piperazin-1-yl]methanone (PubChem CID 34470441) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is furan-2-yl-[4-(3,4,5-trimethoxy-2-nitrobenzoyl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(3,4,5-trimethoxy-2-nitrobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 34470441 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | furan-2-yl-[4-(3,4,5-trimethoxy-2-nitrobenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3ccco3)CC2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H21N3O8/c1-27-14-11-12(15(22(25)26)17(29-3)16(14)28-2)18(23)20-6-8-21(9-7-20)19(24)13-5-4-10-30-13/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | JQHBOSGZABJHLZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 124.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|